C25H32N2O6 — CID 144536162
tert-butyl N-[5-(3-amino-4-hydroxyphenyl)-1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]carbamate (PubChem CID 144536162) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is tert-butyl N-[5-(3-amino-4-hydroxyphenyl)-1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]carbamate.
| Compound Name | tert-butyl N-[5-(3-amino-4-hydroxyphenyl)-1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]carbamate |
|---|---|
| PubChem CID | 144536162 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | tert-butyl N-[5-(3-amino-4-hydroxyphenyl)-1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]carbamate |
| SMILES | COc1cc2c(c(OC)c1OC)CCC(NC(=O)OC(C)(C)C)C=C2c1ccc(O)c(N)c1 |
| InChI | InChI=1S/C25H32N2O6/c1-25(2,3)33-24(29)27-15-8-9-16-18(13-21(30-4)23(32-6)22(16)31-5)17(12-15)14-7-10-20(28)19(26)11-14/h7,10-13,15,28H,8-9,26H2,1-6H3,(H,27,29) |
| InChIKey | ROPOZCBAZZYOTF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|