C24H27N3O9 — CID 89415405
[5-[7-[2-(hydroxyamino)-2-oxoethoxy]imino-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-5-yl]-2-methoxyphenyl]carbamic acid (PubChem CID 89415405) has the molecular formula C24H27N3O9 and a molecular weight of 501.49 g/mol. Its IUPAC name is [5-[7-[2-(hydroxyamino)-2-oxoethoxy]imino-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-5-yl]-2-methoxyphenyl]carbamic acid.
| Compound Name | [5-[7-[2-(hydroxyamino)-2-oxoethoxy]imino-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-5-yl]-2-methoxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 89415405 |
| Molecular Formula | C24H27N3O9 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | [5-[7-[2-(hydroxyamino)-2-oxoethoxy]imino-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-5-yl]-2-methoxyphenyl]carbamic acid |
| SMILES | COc1ccc(C2=CC(=NOCC(=O)NO)CCc3c2cc(OC)c(OC)c3OC)cc1NC(=O)O |
| InChI | InChI=1S/C24H27N3O9/c1-32-19-8-5-13(9-18(19)25-24(29)30)16-10-14(27-36-12-21(28)26-31)6-7-15-17(16)11-20(33-2)23(35-4)22(15)34-3/h5,8-11,25,31H,6-7,12H2,1-4H3,(H,26,28)(H,29,30) |
| InChIKey | HDHPPHNHHULYDI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 157.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|