C23H27N3O7 — CID 78090398
2-[[5-(3-amino-4-methoxyphenyl)-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-7-ylidene]amino]oxy-N-hydroxyacetamide (PubChem CID 78090398) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is 2-[[5-(3-amino-4-methoxyphenyl)-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-7-ylidene]amino]oxy-N-hydroxyacetamide.
| Compound Name | 2-[[5-(3-amino-4-methoxyphenyl)-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-7-ylidene]amino]oxy-N-hydroxyacetamide |
|---|---|
| PubChem CID | 78090398 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[[5-(3-amino-4-methoxyphenyl)-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-7-ylidene]amino]oxy-N-hydroxyacetamide |
| SMILES | COc1ccc(C2=CC(=NOCC(=O)NO)CCc3c2cc(OC)c(OC)c3OC)cc1N |
| InChI | InChI=1S/C23H27N3O7/c1-29-19-8-5-13(9-18(19)24)16-10-14(26-33-12-21(27)25-28)6-7-15-17(16)11-20(30-2)23(32-4)22(15)31-3/h5,8-11,28H,6-7,12,24H2,1-4H3,(H,25,27) |
| InChIKey | PVLDSXMEQBZNIR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|