C24H27NO7 — CID 89416791
5-[(7E)-7-hydroxyimino-1,3-dimethoxy-2-(oxolan-2-yloxy)-8,9-dihydrobenzo[7]annulen-5-yl]-2-methoxyphenol (PubChem CID 89416791) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is 5-[(7E)-7-hydroxyimino-1,3-dimethoxy-2-(oxolan-2-yloxy)-8,9-dihydrobenzo[7]annulen-5-yl]-2-methoxyphenol.
| Compound Name | 5-[(7E)-7-hydroxyimino-1,3-dimethoxy-2-(oxolan-2-yloxy)-8,9-dihydrobenzo[7]annulen-5-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 89416791 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 5-[(7E)-7-hydroxyimino-1,3-dimethoxy-2-(oxolan-2-yloxy)-8,9-dihydrobenzo[7]annulen-5-yl]-2-methoxyphenol |
| SMILES | COc1ccc(C2=C/C(=N/O)CCc3c2cc(OC)c(OC2CCCO2)c3OC)cc1O |
| InChI | InChI=1S/C24H27NO7/c1-28-20-9-6-14(11-19(20)26)17-12-15(25-27)7-8-16-18(17)13-21(29-2)24(23(16)30-3)32-22-5-4-10-31-22/h6,9,11-13,22,26-27H,4-5,7-8,10H2,1-3H3/b25-15+ |
| InChIKey | SWBGQRAUSNGJKI-MFKUBSTISA-N |
| XLogP | 4.14 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|