C30H41NO7Si — CID 172952033
1-[(E)-[5-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-7-ylidene]amino]oxypropan-2-one (PubChem CID 172952033) has the molecular formula C30H41NO7Si and a molecular weight of 555.74 g/mol. Its IUPAC name is 1-[(E)-[5-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-7-ylidene]amino]oxypropan-2-one.
| Compound Name | 1-[(E)-[5-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-7-ylidene]amino]oxypropan-2-one |
|---|---|
| PubChem CID | 172952033 |
| Molecular Formula | C30H41NO7Si |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 1-[(E)-[5-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-1,2,3-trimethoxy-8,9-dihydrobenzo[7]annulen-7-ylidene]amino]oxypropan-2-one |
| SMILES | COc1ccc(C2=C/C(=N/OCC(C)=O)CCc3c2cc(OC)c(OC)c3OC)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H41NO7Si/c1-19(32)18-37-31-21-12-13-22-24(17-27(34-6)29(36-8)28(22)35-7)23(16-21)20-11-14-25(33-5)26(15-20)38-39(9,10)30(2,3)4/h11,14-17H,12-13,18H2,1-10H3/b31-21+ |
| InChIKey | OPIPISCHSVVFHU-NJZRLIGZSA-N |
| XLogP | 6.44 |
| TPSA | 84.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|