C39H49F3N4O9 — CID 71506379
2-[(3-amino-2-hydroxy-4-phenylbutanoyl)amino]-N-[5-(3-amino-4-methoxyphenyl)-1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]-4-methylpentanamide;2,2,2-trifluoroacetic acid (PubChem CID 71506379) has the molecular formula C39H49F3N4O9 and a molecular weight of 774.83 g/mol. Its IUPAC name is 2-[(3-amino-2-hydroxy-4-phenylbutanoyl)amino]-N-[5-(3-amino-4-methoxyphenyl)-1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]-4-methylpentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3-amino-2-hydroxy-4-phenylbutanoyl)amino]-N-[5-(3-amino-4-methoxyphenyl)-1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]-4-methylpentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71506379 |
| Molecular Formula | C39H49F3N4O9 |
| Molecular Weight | 774.83 g/mol |
| Exact Mass | 774.35 |
| IUPAC Name | 2-[(3-amino-2-hydroxy-4-phenylbutanoyl)amino]-N-[5-(3-amino-4-methoxyphenyl)-1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]-4-methylpentanamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C2=CC(NC(=O)C(CC(C)C)NC(=O)C(O)C(N)Cc3ccccc3)CCc3c2cc(OC)c(OC)c3OC)cc1N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C37H48N4O7.C2HF3O2/c1-21(2)16-30(41-37(44)33(42)29(39)17-22-10-8-7-9-11-22)36(43)40-24-13-14-25-27(20-32(46-4)35(48-6)34(25)47-5)26(19-24)23-12-15-31(45-3)28(38)18-23;3-2(4,5)1(6)7/h7-12,15,18-21,24,29-30,33,42H,13-14,16-17,38-39H2,1-6H3,(H,40,43)(H,41,44);(H,6,7) |
| InChIKey | MZZCBVSKNFLLKY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 204.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.83 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|