C16H23IN2O4 — CID 166849189
iodo (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate (PubChem CID 166849189) has the molecular formula C16H23IN2O4 and a molecular weight of 434.27 g/mol. Its IUPAC name is iodo (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate.
| Compound Name | iodo (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 166849189 |
| Molecular Formula | C16H23IN2O4 |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | iodo (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(=O)OI |
| InChI | InChI=1S/C16H23IN2O4/c1-10(2)8-13(16(22)23-17)19-15(21)14(20)12(18)9-11-6-4-3-5-7-11/h3-7,10,12-14,20H,8-9,18H2,1-2H3,(H,19,21)/t12-,13+,14+/m1/s1 |
| InChIKey | RGNBKRMITCNOLC-RDBSUJKOSA-N |
| XLogP | 1.34 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|