C25H30O3 — CID 173152541
[4-[2-[3-(6-hydroxydeca-2,4-dien-2-yl)phenyl]ethenyl]phenyl]methanediol (PubChem CID 173152541) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is [4-[2-[3-(6-hydroxydeca-2,4-dien-2-yl)phenyl]ethenyl]phenyl]methanediol.
| Compound Name | [4-[2-[3-(6-hydroxydeca-2,4-dien-2-yl)phenyl]ethenyl]phenyl]methanediol |
|---|---|
| PubChem CID | 173152541 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | [4-[2-[3-(6-hydroxydeca-2,4-dien-2-yl)phenyl]ethenyl]phenyl]methanediol |
| SMILES | CCCCC(O)C=CC=C(C)c1cccc(C=Cc2ccc(C(O)O)cc2)c1 |
| InChI | InChI=1S/C25H30O3/c1-3-4-10-24(26)11-5-7-19(2)23-9-6-8-21(18-23)13-12-20-14-16-22(17-15-20)25(27)28/h5-9,11-18,24-28H,3-4,10H2,1-2H3 |
| InChIKey | XGCQUCWWKXSHCQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|