C28H48O5 — CID 54276372
1-[2-(1-acetyloxy-5-hydroxypentyl)cyclohexyl]trideca-1,3-dien-5-yl acetate (PubChem CID 54276372) has the molecular formula C28H48O5 and a molecular weight of 464.69 g/mol. Its IUPAC name is 1-[2-(1-acetyloxy-5-hydroxypentyl)cyclohexyl]trideca-1,3-dien-5-yl acetate.
| Compound Name | 1-[2-(1-acetyloxy-5-hydroxypentyl)cyclohexyl]trideca-1,3-dien-5-yl acetate |
|---|---|
| PubChem CID | 54276372 |
| Molecular Formula | C28H48O5 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | 1-[2-(1-acetyloxy-5-hydroxypentyl)cyclohexyl]trideca-1,3-dien-5-yl acetate |
| SMILES | CCCCCCCCC(C=CC=CC1CCCCC1C(CCCCO)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C28H48O5/c1-4-5-6-7-8-9-18-26(32-23(2)30)19-12-10-16-25-17-11-13-20-27(25)28(33-24(3)31)21-14-15-22-29/h10,12,16,19,25-29H,4-9,11,13-15,17-18,20-22H2,1-3H3 |
| InChIKey | RNRWRPTZDFYLCI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|