C27H44O5 — CID 54124855
methyl 5-acetyloxy-5-[6-(13-hydroxytrideca-1,3-dienyl)cyclohex-3-en-1-yl]pentanoate (PubChem CID 54124855) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is methyl 5-acetyloxy-5-[6-(13-hydroxytrideca-1,3-dienyl)cyclohex-3-en-1-yl]pentanoate.
| Compound Name | methyl 5-acetyloxy-5-[6-(13-hydroxytrideca-1,3-dienyl)cyclohex-3-en-1-yl]pentanoate |
|---|---|
| PubChem CID | 54124855 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | methyl 5-acetyloxy-5-[6-(13-hydroxytrideca-1,3-dienyl)cyclohex-3-en-1-yl]pentanoate |
| SMILES | COC(=O)CCCC(OC(C)=O)C1CC=CCC1C=CC=CCCCCCCCCCO |
| InChI | InChI=1S/C27H44O5/c1-23(29)32-26(20-16-21-27(30)31-2)25-19-14-13-18-24(25)17-12-10-8-6-4-3-5-7-9-11-15-22-28/h8,10,12-14,17,24-26,28H,3-7,9,11,15-16,18-22H2,1-2H3 |
| InChIKey | NQFOTDNWXGSVCZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|