C17H32O4 — CID 102277026
[(E,6R,9S,10S)-9,10-dihydroxypentadec-7-en-6-yl] acetate (PubChem CID 102277026) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is [(E,6R,9S,10S)-9,10-dihydroxypentadec-7-en-6-yl] acetate.
| Compound Name | [(E,6R,9S,10S)-9,10-dihydroxypentadec-7-en-6-yl] acetate |
|---|---|
| PubChem CID | 102277026 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | [(E,6R,9S,10S)-9,10-dihydroxypentadec-7-en-6-yl] acetate |
| SMILES | CCCCC[C@H](/C=C/[C@H](O)[C@@H](O)CCCCC)OC(C)=O |
| InChI | InChI=1S/C17H32O4/c1-4-6-8-10-15(21-14(3)18)12-13-17(20)16(19)11-9-7-5-2/h12-13,15-17,19-20H,4-11H2,1-3H3/b13-12+/t15-,16+,17+/m1/s1 |
| InChIKey | CIXNTFADTKFGGT-YQQRWFEWSA-N |
| XLogP | 3.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|