C40H56O2Si — CID 19773790
(1E,3E)-1-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]phenyl]trideca-1,3-dien-5-ol (PubChem CID 19773790) has the molecular formula C40H56O2Si and a molecular weight of 596.97 g/mol. Its IUPAC name is (1E,3E)-1-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]phenyl]trideca-1,3-dien-5-ol.
| Compound Name | (1E,3E)-1-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]phenyl]trideca-1,3-dien-5-ol |
|---|---|
| PubChem CID | 19773790 |
| Molecular Formula | C40H56O2Si |
| Molecular Weight | 596.97 g/mol |
| Exact Mass | 596.40 |
| IUPAC Name | (1E,3E)-1-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]phenyl]trideca-1,3-dien-5-ol |
| SMILES | CCCCCCCCC(O)/C=C/C=C/c1ccccc1CCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H56O2Si/c1-5-6-7-8-9-14-28-37(41)29-22-21-27-36-26-20-19-25-35(36)24-13-12-23-34-42-43(40(2,3)4,38-30-15-10-16-31-38)39-32-17-11-18-33-39/h10-11,15-22,25-27,29-33,37,41H,5-9,12-14,23-24,28,34H2,1-4H3/b27-21+,29-22+ |
| InChIKey | NUQGZHDFJRNOBP-CTXMBUNGSA-N |
| XLogP | 9.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.97 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|