C24H34OSi — CID 101387251
(E)-1-[tert-butyl(diphenyl)silyl]oct-1-en-3-ol (PubChem CID 101387251) has the molecular formula C24H34OSi and a molecular weight of 366.62 g/mol. Its IUPAC name is (E)-1-[tert-butyl(diphenyl)silyl]oct-1-en-3-ol.
| Compound Name | (E)-1-[tert-butyl(diphenyl)silyl]oct-1-en-3-ol |
|---|---|
| PubChem CID | 101387251 |
| Molecular Formula | C24H34OSi |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (E)-1-[tert-butyl(diphenyl)silyl]oct-1-en-3-ol |
| SMILES | CCCCCC(O)/C=C/[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H34OSi/c1-5-6-9-14-21(25)19-20-26(24(2,3)4,22-15-10-7-11-16-22)23-17-12-8-13-18-23/h7-8,10-13,15-21,25H,5-6,9,14H2,1-4H3/b20-19+ |
| InChIKey | UDXCNTYKOLAZPW-FMQUCBEESA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|