C21H30O5 — CID 59210595
dimethyl 6-[(E)-2-(2-hydroxyphenyl)ethenyl]undecanedioate (PubChem CID 59210595) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is dimethyl 6-[(E)-2-(2-hydroxyphenyl)ethenyl]undecanedioate.
| Compound Name | dimethyl 6-[(E)-2-(2-hydroxyphenyl)ethenyl]undecanedioate |
|---|---|
| PubChem CID | 59210595 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | dimethyl 6-[(E)-2-(2-hydroxyphenyl)ethenyl]undecanedioate |
| SMILES | COC(=O)CCCCC(/C=C/c1ccccc1O)CCCCC(=O)OC |
| InChI | InChI=1S/C21H30O5/c1-25-20(23)13-7-3-9-17(10-4-8-14-21(24)26-2)15-16-18-11-5-6-12-19(18)22/h5-6,11-12,15-17,22H,3-4,7-10,13-14H2,1-2H3/b16-15+ |
| InChIKey | GNWKULVKNKVLJO-FOCLMDBBSA-N |
| XLogP | 4.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|