C26H32O5 — CID 74018138
ethyl 4-[7-ethoxy-2-[2-(2-hydroxyphenyl)ethenyl]-7-oxoheptyl]benzoate (PubChem CID 74018138) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is ethyl 4-[7-ethoxy-2-[2-(2-hydroxyphenyl)ethenyl]-7-oxoheptyl]benzoate.
| Compound Name | ethyl 4-[7-ethoxy-2-[2-(2-hydroxyphenyl)ethenyl]-7-oxoheptyl]benzoate |
|---|---|
| PubChem CID | 74018138 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | ethyl 4-[7-ethoxy-2-[2-(2-hydroxyphenyl)ethenyl]-7-oxoheptyl]benzoate |
| SMILES | CCOC(=O)CCCCC(C=Cc1ccccc1O)Cc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C26H32O5/c1-3-30-25(28)12-8-5-9-20(13-16-22-10-6-7-11-24(22)27)19-21-14-17-23(18-15-21)26(29)31-4-2/h6-7,10-11,13-18,20,27H,3-5,8-9,12,19H2,1-2H3 |
| InChIKey | UMJAFURPZIZICE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|