C20H32O4Si — CID 68706971
(E)-8-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-hydroxyoct-7-enoic acid (PubChem CID 68706971) has the molecular formula C20H32O4Si and a molecular weight of 364.50 g/mol. Its IUPAC name is (E)-8-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-hydroxyoct-7-enoic acid.
| Compound Name | (E)-8-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-hydroxyoct-7-enoic acid |
|---|---|
| PubChem CID | 68706971 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | (E)-8-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-hydroxyoct-7-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=CC=C1/C=C/C(CCCCC(=O)O)O |
| InChI | InChI=1S/C20H32O4Si/c1-20(2,3)25(4,5)24-18-12-8-6-10-16(18)14-15-17(21)11-7-9-13-19(22)23/h6,8,10,12,14-15,17,21H,7,9,11,13H2,1-5H3,(H,22,23)/b15-14+ |
| InChIKey | JJCNJCIHBIHRFM-CCEZHUSRSA-N |
| XLogP | — |
| TPSA | 66.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | 439 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|