C21H32O4Si — CID 68710702
methyl 8-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-oxooct-7-enoate (PubChem CID 68710702) has the molecular formula C21H32O4Si and a molecular weight of 376.57 g/mol. Its IUPAC name is methyl 8-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-oxooct-7-enoate.
| Compound Name | methyl 8-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-oxooct-7-enoate |
|---|---|
| PubChem CID | 68710702 |
| Molecular Formula | C21H32O4Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | methyl 8-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-oxooct-7-enoate |
| SMILES | COC(=O)CCCCC(=O)C=Cc1ccccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O4Si/c1-21(2,3)26(5,6)25-19-13-9-7-11-17(19)15-16-18(22)12-8-10-14-20(23)24-4/h7,9,11,13,15-16H,8,10,12,14H2,1-6H3 |
| InChIKey | YJBKSILOHQOJON-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|