C33H35NO7 — CID 59437432
4-[(E)-3-[(4-carboxyphenyl)methyl]-5-[2-[3-(3-oxomorpholin-4-yl)propoxy]phenyl]pent-4-enyl]benzoic acid (PubChem CID 59437432) has the molecular formula C33H35NO7 and a molecular weight of 557.64 g/mol. Its IUPAC name is 4-[(E)-3-[(4-carboxyphenyl)methyl]-5-[2-[3-(3-oxomorpholin-4-yl)propoxy]phenyl]pent-4-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[(4-carboxyphenyl)methyl]-5-[2-[3-(3-oxomorpholin-4-yl)propoxy]phenyl]pent-4-enyl]benzoic acid |
|---|---|
| PubChem CID | 59437432 |
| Molecular Formula | C33H35NO7 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 4-[(E)-3-[(4-carboxyphenyl)methyl]-5-[2-[3-(3-oxomorpholin-4-yl)propoxy]phenyl]pent-4-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCC(/C=C/c2ccccc2OCCCN2CCOCC2=O)Cc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C33H35NO7/c35-31-23-40-21-19-34(31)18-3-20-41-30-5-2-1-4-27(30)13-10-25(22-26-11-16-29(17-12-26)33(38)39)7-6-24-8-14-28(15-9-24)32(36)37/h1-2,4-5,8-17,25H,3,6-7,18-23H2,(H,36,37)(H,38,39)/b13-10+ |
| InChIKey | OFVTWKCPSBFSBR-JLHYYAGUSA-N |
| XLogP | 5.22 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|