C33H38O5 — CID 19755683
4-[6-carboxy-2-[(E)-2-[3-(5-phenoxypentyl)phenyl]ethenyl]hexyl]benzoic acid (PubChem CID 19755683) has the molecular formula C33H38O5 and a molecular weight of 514.66 g/mol. Its IUPAC name is 4-[6-carboxy-2-[(E)-2-[3-(5-phenoxypentyl)phenyl]ethenyl]hexyl]benzoic acid.
| Compound Name | 4-[6-carboxy-2-[(E)-2-[3-(5-phenoxypentyl)phenyl]ethenyl]hexyl]benzoic acid |
|---|---|
| PubChem CID | 19755683 |
| Molecular Formula | C33H38O5 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 4-[6-carboxy-2-[(E)-2-[3-(5-phenoxypentyl)phenyl]ethenyl]hexyl]benzoic acid |
| SMILES | O=C(O)CCCCC(/C=C/c1cccc(CCCCCOc2ccccc2)c1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H38O5/c34-32(35)16-7-6-11-27(25-29-19-21-30(22-20-29)33(36)37)17-18-28-13-9-12-26(24-28)10-3-2-8-23-38-31-14-4-1-5-15-31/h1,4-5,9,12-15,17-22,24,27H,2-3,6-8,10-11,16,23,25H2,(H,34,35)(H,36,37)/b18-17+ |
| InChIKey | HVGZJEPPDOIRLD-ISLYRVAYSA-N |
| XLogP | 7.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|