C33H38O6 — CID 67853252
4-[(Z)-2-(4-carboxybutyl)-6-[4-(3-phenoxypropoxy)phenyl]hex-3-enyl]benzoic acid (PubChem CID 67853252) has the molecular formula C33H38O6 and a molecular weight of 530.66 g/mol. Its IUPAC name is 4-[(Z)-2-(4-carboxybutyl)-6-[4-(3-phenoxypropoxy)phenyl]hex-3-enyl]benzoic acid.
| Compound Name | 4-[(Z)-2-(4-carboxybutyl)-6-[4-(3-phenoxypropoxy)phenyl]hex-3-enyl]benzoic acid |
|---|---|
| PubChem CID | 67853252 |
| Molecular Formula | C33H38O6 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 4-[(Z)-2-(4-carboxybutyl)-6-[4-(3-phenoxypropoxy)phenyl]hex-3-enyl]benzoic acid |
| SMILES | O=C(O)CCCCC(/C=C\CCc1ccc(OCCCOc2ccccc2)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H38O6/c34-32(35)14-7-6-11-27(25-28-15-19-29(20-16-28)33(36)37)10-5-4-9-26-17-21-31(22-18-26)39-24-8-23-38-30-12-2-1-3-13-30/h1-3,5,10,12-13,15-22,27H,4,6-9,11,14,23-25H2,(H,34,35)(H,36,37)/b10-5- |
| InChIKey | SGBZKYFZDZDAOP-YHYXMXQVSA-N |
| XLogP | 7.23 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|