C32H36O6 — CID 67853288
4-[6-carboxy-2-[(Z)-2-[3-(4-phenoxybutoxy)phenyl]ethenyl]hexyl]benzoic acid (PubChem CID 67853288) has the molecular formula C32H36O6 and a molecular weight of 516.63 g/mol. Its IUPAC name is 4-[6-carboxy-2-[(Z)-2-[3-(4-phenoxybutoxy)phenyl]ethenyl]hexyl]benzoic acid.
| Compound Name | 4-[6-carboxy-2-[(Z)-2-[3-(4-phenoxybutoxy)phenyl]ethenyl]hexyl]benzoic acid |
|---|---|
| PubChem CID | 67853288 |
| Molecular Formula | C32H36O6 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 4-[6-carboxy-2-[(Z)-2-[3-(4-phenoxybutoxy)phenyl]ethenyl]hexyl]benzoic acid |
| SMILES | O=C(O)CCCCC(/C=C\c1cccc(OCCCCOc2ccccc2)c1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H36O6/c33-31(34)14-5-4-9-25(23-27-17-19-28(20-18-27)32(35)36)15-16-26-10-8-13-30(24-26)38-22-7-6-21-37-29-11-2-1-3-12-29/h1-3,8,10-13,15-20,24-25H,4-7,9,14,21-23H2,(H,33,34)(H,35,36)/b16-15- |
| InChIKey | RCRLEWLQJKDTFG-NXVVXOECSA-N |
| XLogP | 7.14 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|