C35H43NO4 — CID 142049452
4-[7-oxo-2-[2-[2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methoxy]phenyl]ethyl]octyl]benzoic acid (PubChem CID 142049452) has the molecular formula C35H43NO4 and a molecular weight of 541.73 g/mol. Its IUPAC name is 4-[7-oxo-2-[2-[2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methoxy]phenyl]ethyl]octyl]benzoic acid.
| Compound Name | 4-[7-oxo-2-[2-[2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methoxy]phenyl]ethyl]octyl]benzoic acid |
|---|---|
| PubChem CID | 142049452 |
| Molecular Formula | C35H43NO4 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | 4-[7-oxo-2-[2-[2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methoxy]phenyl]ethyl]octyl]benzoic acid |
| SMILES | CC(=O)CCCCC(CCc1ccccc1OCc1ccc(CN2CCCC2)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C35H43NO4/c1-27(37)8-2-3-9-28(24-29-17-20-33(21-18-29)35(38)39)16-19-32-10-4-5-11-34(32)40-26-31-14-12-30(13-15-31)25-36-22-6-7-23-36/h4-5,10-15,17-18,20-21,28H,2-3,6-9,16,19,22-26H2,1H3,(H,38,39) |
| InChIKey | BQKSEGTYWKDUKM-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|