C37H46N4O5 — CID 142049502
4-[7-amino-2-[2-[2-[4-[3-cyano-4-(4-hydroxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-7-oxoheptyl]benzoic acid (PubChem CID 142049502) has the molecular formula C37H46N4O5 and a molecular weight of 626.80 g/mol. Its IUPAC name is 4-[7-amino-2-[2-[2-[4-[3-cyano-4-(4-hydroxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-7-oxoheptyl]benzoic acid.
| Compound Name | 4-[7-amino-2-[2-[2-[4-[3-cyano-4-(4-hydroxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-7-oxoheptyl]benzoic acid |
|---|---|
| PubChem CID | 142049502 |
| Molecular Formula | C37H46N4O5 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | 4-[7-amino-2-[2-[2-[4-[3-cyano-4-(4-hydroxyphenyl)piperazin-1-yl]butoxy]phenyl]ethyl]-7-oxoheptyl]benzoic acid |
| SMILES | N#CC1CN(CCCCOc2ccccc2CCC(CCCCC(N)=O)Cc2ccc(C(=O)O)cc2)CCN1c1ccc(O)cc1 |
| InChI | InChI=1S/C37H46N4O5/c38-26-33-27-40(22-23-41(33)32-17-19-34(42)20-18-32)21-5-6-24-46-35-9-3-2-8-30(35)14-11-28(7-1-4-10-36(39)43)25-29-12-15-31(16-13-29)37(44)45/h2-3,8-9,12-13,15-20,28,33,42H,1,4-7,10-11,14,21-25,27H2,(H2,39,43)(H,44,45) |
| InChIKey | VDUBAMRDKJFNHY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|