C26H29Cl2NO3 — CID 66853150
1-[[6-[3-(4-chlorophenyl)propoxy]naphthalen-2-yl]methyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 66853150) has the molecular formula C26H29Cl2NO3 and a molecular weight of 474.43 g/mol. Its IUPAC name is 1-[[6-[3-(4-chlorophenyl)propoxy]naphthalen-2-yl]methyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[[6-[3-(4-chlorophenyl)propoxy]naphthalen-2-yl]methyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 66853150 |
| Molecular Formula | C26H29Cl2NO3 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 1-[[6-[3-(4-chlorophenyl)propoxy]naphthalen-2-yl]methyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCN(Cc2ccc3cc(OCCCc4ccc(Cl)cc4)ccc3c2)CC1 |
| InChI | InChI=1S/C26H28ClNO3.ClH/c27-24-8-4-19(5-9-24)2-1-15-31-25-10-7-22-16-20(3-6-23(22)17-25)18-28-13-11-21(12-14-28)26(29)30;/h3-10,16-17,21H,1-2,11-15,18H2,(H,29,30);1H |
| InChIKey | JTPBUIODLIRXBF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|