C24H27Cl2NO5 — CID 70054801
4-[2-(3,4-dichlorophenoxy)ethyl]-1-[(E)-3-phenylprop-2-enyl]piperidine;oxalic acid (PubChem CID 70054801) has the molecular formula C24H27Cl2NO5 and a molecular weight of 480.39 g/mol. Its IUPAC name is 4-[2-(3,4-dichlorophenoxy)ethyl]-1-[(E)-3-phenylprop-2-enyl]piperidine;oxalic acid.
| Compound Name | 4-[2-(3,4-dichlorophenoxy)ethyl]-1-[(E)-3-phenylprop-2-enyl]piperidine;oxalic acid |
|---|---|
| PubChem CID | 70054801 |
| Molecular Formula | C24H27Cl2NO5 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 4-[2-(3,4-dichlorophenoxy)ethyl]-1-[(E)-3-phenylprop-2-enyl]piperidine;oxalic acid |
| SMILES | Clc1ccc(OCCC2CCN(C/C=C/c3ccccc3)CC2)cc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H25Cl2NO.C2H2O4/c23-21-9-8-20(17-22(21)24)26-16-12-19-10-14-25(15-11-19)13-4-7-18-5-2-1-3-6-18;3-1(4)2(5)6/h1-9,17,19H,10-16H2;(H,3,4)(H,5,6)/b7-4+; |
| InChIKey | WLAANLRXJJRQBZ-KQGICBIGSA-N |
| XLogP | 5.34 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|