C19H15ClN6O4 — CID 137224526
4-[[4-[(5-chloro-2-hydroxy-3-nitrosoindol-1-yl)methyl]triazol-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 137224526) has the molecular formula C19H15ClN6O4 and a molecular weight of 426.82 g/mol. Its IUPAC name is 4-[[4-[(5-chloro-2-hydroxy-3-nitrosoindol-1-yl)methyl]triazol-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[4-[(5-chloro-2-hydroxy-3-nitrosoindol-1-yl)methyl]triazol-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 137224526 |
| Molecular Formula | C19H15ClN6O4 |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 4-[[4-[(5-chloro-2-hydroxy-3-nitrosoindol-1-yl)methyl]triazol-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | O=Nc1c(O)n(Cc2cn(Cc3ccc(C(=O)NO)cc3)nn2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H15ClN6O4/c20-13-5-6-16-15(7-13)17(22-29)19(28)26(16)10-14-9-25(24-21-14)8-11-1-3-12(4-2-11)18(27)23-30/h1-7,9,28,30H,8,10H2,(H,23,27) |
| InChIKey | BYQUDVRYAYIREL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|