C20H17ClN10O3 — CID 172965313
[(Z)-[2-[4-[[3-(carbamoyldiazenyl)-5-chloro-2-hydroxyindol-1-yl]methyl]triazol-1-yl]phenyl]methylideneamino]urea (PubChem CID 172965313) has the molecular formula C20H17ClN10O3 and a molecular weight of 480.88 g/mol. Its IUPAC name is [(Z)-[2-[4-[[3-(carbamoyldiazenyl)-5-chloro-2-hydroxyindol-1-yl]methyl]triazol-1-yl]phenyl]methylideneamino]urea.
| Compound Name | [(Z)-[2-[4-[[3-(carbamoyldiazenyl)-5-chloro-2-hydroxyindol-1-yl]methyl]triazol-1-yl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 172965313 |
| Molecular Formula | C20H17ClN10O3 |
| Molecular Weight | 480.88 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | [(Z)-[2-[4-[[3-(carbamoyldiazenyl)-5-chloro-2-hydroxyindol-1-yl]methyl]triazol-1-yl]phenyl]methylideneamino]urea |
| SMILES | NC(=O)/N=N/c1c(O)n(Cc2cn(-c3ccccc3/C=N\NC(N)=O)nn2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H17ClN10O3/c21-12-5-6-16-14(7-12)17(26-28-20(23)34)18(32)30(16)9-13-10-31(29-25-13)15-4-2-1-3-11(15)8-24-27-19(22)33/h1-8,10,32H,9H2,(H2,23,34)(H3,22,27,33)/b24-8-,28-26+ |
| InChIKey | IKBPYEHOHJPEKM-KPINFZPBSA-N |
| XLogP | 2.79 |
| TPSA | 191.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|