C15H15ClN6O4 — CID 137306424
4-[4-[(7-chloro-2-hydroxy-3-nitrosoindol-1-yl)methyl]triazol-1-yl]-N-hydroxybutanamide (PubChem CID 137306424) has the molecular formula C15H15ClN6O4 and a molecular weight of 378.78 g/mol. Its IUPAC name is 4-[4-[(7-chloro-2-hydroxy-3-nitrosoindol-1-yl)methyl]triazol-1-yl]-N-hydroxybutanamide.
| Compound Name | 4-[4-[(7-chloro-2-hydroxy-3-nitrosoindol-1-yl)methyl]triazol-1-yl]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 137306424 |
| Molecular Formula | C15H15ClN6O4 |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-[4-[(7-chloro-2-hydroxy-3-nitrosoindol-1-yl)methyl]triazol-1-yl]-N-hydroxybutanamide |
| SMILES | O=Nc1c(O)n(Cc2cn(CCCC(=O)NO)nn2)c2c(Cl)cccc12 |
| InChI | InChI=1S/C15H15ClN6O4/c16-11-4-1-3-10-13(19-26)15(24)22(14(10)11)8-9-7-21(20-17-9)6-2-5-12(23)18-25/h1,3-4,7,24-25H,2,5-6,8H2,(H,18,23) |
| InChIKey | RCTYPJMVVHUOJR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|