C15H19BrN4O3 — CID 141272283
5-[1-[(2-bromo-3-methoxyphenyl)methyl]triazol-4-yl]-N-hydroxypentanamide (PubChem CID 141272283) has the molecular formula C15H19BrN4O3 and a molecular weight of 383.25 g/mol. Its IUPAC name is 5-[1-[(2-bromo-3-methoxyphenyl)methyl]triazol-4-yl]-N-hydroxypentanamide.
| Compound Name | 5-[1-[(2-bromo-3-methoxyphenyl)methyl]triazol-4-yl]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 141272283 |
| Molecular Formula | C15H19BrN4O3 |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 5-[1-[(2-bromo-3-methoxyphenyl)methyl]triazol-4-yl]-N-hydroxypentanamide |
| SMILES | COc1cccc(Cn2cc(CCCCC(=O)NO)nn2)c1Br |
| InChI | InChI=1S/C15H19BrN4O3/c1-23-13-7-4-5-11(15(13)16)9-20-10-12(17-19-20)6-2-3-8-14(21)18-22/h4-5,7,10,22H,2-3,6,8-9H2,1H3,(H,18,21) |
| InChIKey | WHBNYBDMZIOEDZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|