C19H23N7O2 — CID 171349979
N-[3-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]propyl]-2-methoxybenzamide (PubChem CID 171349979) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[3-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]propyl]-2-methoxybenzamide.
| Compound Name | N-[3-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]propyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 171349979 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[3-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]propyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCCCc1cn(Cc2cnc(C)nc2N)nn1 |
| InChI | InChI=1S/C19H23N7O2/c1-13-22-10-14(18(20)23-13)11-26-12-15(24-25-26)6-5-9-21-19(27)16-7-3-4-8-17(16)28-2/h3-4,7-8,10,12H,5-6,9,11H2,1-2H3,(H,21,27)(H2,20,22,23) |
| InChIKey | FTKVMPMBBLDTQE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|