C33H37F5N2O3S — CID 10233049
2-(4-hydroxyphenyl)-3-methyl-1-[[4-[2-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]ethoxy]phenyl]methyl]indol-5-ol (PubChem CID 10233049) has the molecular formula C33H37F5N2O3S and a molecular weight of 636.73 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-3-methyl-1-[[4-[2-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]ethoxy]phenyl]methyl]indol-5-ol.
| Compound Name | 2-(4-hydroxyphenyl)-3-methyl-1-[[4-[2-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]ethoxy]phenyl]methyl]indol-5-ol |
|---|---|
| PubChem CID | 10233049 |
| Molecular Formula | C33H37F5N2O3S |
| Molecular Weight | 636.73 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | 2-(4-hydroxyphenyl)-3-methyl-1-[[4-[2-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]ethoxy]phenyl]methyl]indol-5-ol |
| SMILES | Cc1c(-c2ccc(O)cc2)n(Cc2ccc(OCCN(C)CCCSCCCC(F)(F)C(F)(F)F)cc2)c2ccc(O)cc12 |
| InChI | InChI=1S/C33H37F5N2O3S/c1-23-29-21-27(42)11-14-30(29)40(31(23)25-7-9-26(41)10-8-25)22-24-5-12-28(13-6-24)43-18-17-39(2)16-4-20-44-19-3-15-32(34,35)33(36,37)38/h5-14,21,41-42H,3-4,15-20,22H2,1-2H3 |
| InChIKey | GJUJYKLFFUMFMC-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.73 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|