C20H28NO5P — CID 171192302
(R)-diethoxyphosphoryl-(3-ethoxy-4-phenylmethoxyphenyl)methanamine (PubChem CID 171192302) has the molecular formula C20H28NO5P and a molecular weight of 393.42 g/mol. Its IUPAC name is (R)-diethoxyphosphoryl-(3-ethoxy-4-phenylmethoxyphenyl)methanamine.
| Compound Name | (R)-diethoxyphosphoryl-(3-ethoxy-4-phenylmethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 171192302 |
| Molecular Formula | C20H28NO5P |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (R)-diethoxyphosphoryl-(3-ethoxy-4-phenylmethoxyphenyl)methanamine |
| SMILES | CCOc1cc([C@H](N)P(=O)(OCC)OCC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H28NO5P/c1-4-23-19-14-17(20(21)27(22,25-5-2)26-6-3)12-13-18(19)24-15-16-10-8-7-9-11-16/h7-14,20H,4-6,15,21H2,1-3H3/t20-/m1/s1 |
| InChIKey | OXDHWYIABBRMHD-HXUWFJFHSA-N |
| XLogP | 4.89 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|