C21H23F3N2O5 — CID 143825452
4-methoxy-N-(3-methoxypropylcarbamoyl)-5-phenylmethoxy-2-(trifluoromethyl)benzamide (PubChem CID 143825452) has the molecular formula C21H23F3N2O5 and a molecular weight of 440.42 g/mol. Its IUPAC name is 4-methoxy-N-(3-methoxypropylcarbamoyl)-5-phenylmethoxy-2-(trifluoromethyl)benzamide.
| Compound Name | 4-methoxy-N-(3-methoxypropylcarbamoyl)-5-phenylmethoxy-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 143825452 |
| Molecular Formula | C21H23F3N2O5 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 4-methoxy-N-(3-methoxypropylcarbamoyl)-5-phenylmethoxy-2-(trifluoromethyl)benzamide |
| SMILES | COCCCNC(=O)NC(=O)c1cc(OCc2ccccc2)c(OC)cc1C(F)(F)F |
| InChI | InChI=1S/C21H23F3N2O5/c1-29-10-6-9-25-20(28)26-19(27)15-11-18(31-13-14-7-4-3-5-8-14)17(30-2)12-16(15)21(22,23)24/h3-5,7-8,11-12H,6,9-10,13H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | BBCAKTLLJKQZLE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|