C15H19F3N2O5 — CID 70260452
N-(3-ethoxypropylcarbamoyl)-5-hydroxy-4-methoxy-2-(trifluoromethyl)benzamide (PubChem CID 70260452) has the molecular formula C15H19F3N2O5 and a molecular weight of 364.32 g/mol. Its IUPAC name is N-(3-ethoxypropylcarbamoyl)-5-hydroxy-4-methoxy-2-(trifluoromethyl)benzamide.
| Compound Name | N-(3-ethoxypropylcarbamoyl)-5-hydroxy-4-methoxy-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 70260452 |
| Molecular Formula | C15H19F3N2O5 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(3-ethoxypropylcarbamoyl)-5-hydroxy-4-methoxy-2-(trifluoromethyl)benzamide |
| SMILES | CCOCCCNC(=O)NC(=O)c1cc(O)c(OC)cc1C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O5/c1-3-25-6-4-5-19-14(23)20-13(22)9-7-11(21)12(24-2)8-10(9)15(16,17)18/h7-8,21H,3-6H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | VGCFLVOWOTUXCN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|