C14H17F3N2O4 — CID 70261119
N-(tert-butylcarbamoyl)-5-hydroxy-4-methoxy-2-(trifluoromethyl)benzamide (PubChem CID 70261119) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-5-hydroxy-4-methoxy-2-(trifluoromethyl)benzamide.
| Compound Name | N-(tert-butylcarbamoyl)-5-hydroxy-4-methoxy-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 70261119 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(tert-butylcarbamoyl)-5-hydroxy-4-methoxy-2-(trifluoromethyl)benzamide |
| SMILES | COc1cc(C(F)(F)F)c(C(=O)NC(=O)NC(C)(C)C)cc1O |
| InChI | InChI=1S/C14H17F3N2O4/c1-13(2,3)19-12(22)18-11(21)7-5-9(20)10(23-4)6-8(7)14(15,16)17/h5-6,20H,1-4H3,(H2,18,19,21,22) |
| InChIKey | NJELUANVXPFYSD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |