C27H38N4O5 — CID 24574969
2-[4-[2-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 24574969) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is 2-[4-[2-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-[2-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 24574969 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 2-[4-[2-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1CCN(CC(=O)NCc2ccc(OCc3ccccc3)c(OC)c2)CC1 |
| InChI | InChI=1S/C27H38N4O5/c1-34-16-6-11-28-26(32)19-30-12-14-31(15-13-30)20-27(33)29-18-23-9-10-24(25(17-23)35-2)36-21-22-7-4-3-5-8-22/h3-5,7-10,17H,6,11-16,18-21H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | AULXWFPXWLBCCK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|