C24H26N2O4S — CID 27865916
N-[4-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 27865916) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[4-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 27865916 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[4-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | COc1cc(CNC(=O)CCCNC(=O)c2cccs2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-29-21-15-19(11-12-20(21)30-17-18-7-3-2-4-8-18)16-26-23(27)10-5-13-25-24(28)22-9-6-14-31-22/h2-4,6-9,11-12,14-15H,5,10,13,16-17H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | BYXXKFJSNJSLKR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|