C19H20BrNO4 — CID 66611351
4-bromo-5-(morpholin-4-ylmethyl)-2-phenylmethoxybenzoic acid (PubChem CID 66611351) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is 4-bromo-5-(morpholin-4-ylmethyl)-2-phenylmethoxybenzoic acid.
| Compound Name | 4-bromo-5-(morpholin-4-ylmethyl)-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 66611351 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-bromo-5-(morpholin-4-ylmethyl)-2-phenylmethoxybenzoic acid |
| SMILES | O=C(O)c1cc(CN2CCOCC2)c(Br)cc1OCc1ccccc1 |
| InChI | InChI=1S/C19H20BrNO4/c20-17-11-18(25-13-14-4-2-1-3-5-14)16(19(22)23)10-15(17)12-21-6-8-24-9-7-21/h1-5,10-11H,6-9,12-13H2,(H,22,23) |
| InChIKey | JAPFWYGAVYFRRK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |