C17H13ClO5 — CID 178077193
3-chloro-5-(1,3-dioxol-2-yl)-4-phenylmethoxybenzoic acid (PubChem CID 178077193) has the molecular formula C17H13ClO5 and a molecular weight of 332.74 g/mol. Its IUPAC name is 3-chloro-5-(1,3-dioxol-2-yl)-4-phenylmethoxybenzoic acid.
| Compound Name | 3-chloro-5-(1,3-dioxol-2-yl)-4-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 178077193 |
| Molecular Formula | C17H13ClO5 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-chloro-5-(1,3-dioxol-2-yl)-4-phenylmethoxybenzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(OCc2ccccc2)c(C2OC=CO2)c1 |
| InChI | InChI=1S/C17H13ClO5/c18-14-9-12(16(19)20)8-13(17-21-6-7-22-17)15(14)23-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,19,20) |
| InChIKey | IEBJPPDNXJJNFV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |