C16H12BrFO3 — CID 178077173
2-(5-bromo-4-fluoro-2-phenylmethoxyphenyl)-1,3-dioxole (PubChem CID 178077173) has the molecular formula C16H12BrFO3 and a molecular weight of 351.17 g/mol. Its IUPAC name is 2-(5-bromo-4-fluoro-2-phenylmethoxyphenyl)-1,3-dioxole.
| Compound Name | 2-(5-bromo-4-fluoro-2-phenylmethoxyphenyl)-1,3-dioxole |
|---|---|
| PubChem CID | 178077173 |
| Molecular Formula | C16H12BrFO3 |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2-(5-bromo-4-fluoro-2-phenylmethoxyphenyl)-1,3-dioxole |
| SMILES | Fc1cc(OCc2ccccc2)c(C2OC=CO2)cc1Br |
| InChI | InChI=1S/C16H12BrFO3/c17-13-8-12(16-19-6-7-20-16)15(9-14(13)18)21-10-11-4-2-1-3-5-11/h1-9,16H,10H2 |
| InChIKey | CZOHOIDPSTWRDA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |