C32H32FO2P — CID 70807483
1-[2-[2-(3,5-dibenzyl-2-hydroxyphenyl)butan-2-ylphosphanyl]-5-fluorophenyl]ethanone (PubChem CID 70807483) has the molecular formula C32H32FO2P and a molecular weight of 498.58 g/mol. Its IUPAC name is 1-[2-[2-(3,5-dibenzyl-2-hydroxyphenyl)butan-2-ylphosphanyl]-5-fluorophenyl]ethanone.
| Compound Name | 1-[2-[2-(3,5-dibenzyl-2-hydroxyphenyl)butan-2-ylphosphanyl]-5-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 70807483 |
| Molecular Formula | C32H32FO2P |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 1-[2-[2-(3,5-dibenzyl-2-hydroxyphenyl)butan-2-ylphosphanyl]-5-fluorophenyl]ethanone |
| SMILES | CCC(C)(Pc1ccc(F)cc1C(C)=O)c1cc(Cc2ccccc2)cc(Cc2ccccc2)c1O |
| InChI | InChI=1S/C32H32FO2P/c1-4-32(3,36-30-16-15-27(33)21-28(30)22(2)34)29-20-25(17-23-11-7-5-8-12-23)19-26(31(29)35)18-24-13-9-6-10-14-24/h5-16,19-21,35-36H,4,17-18H2,1-3H3 |
| InChIKey | OZARNTJXWFVHPR-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|