C22H21NO2 — CID 163237018
2-(3,5-dibenzyl-2-hydroxyphenyl)acetamide (PubChem CID 163237018) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(3,5-dibenzyl-2-hydroxyphenyl)acetamide.
| Compound Name | 2-(3,5-dibenzyl-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 163237018 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-(3,5-dibenzyl-2-hydroxyphenyl)acetamide |
| SMILES | NC(=O)Cc1cc(Cc2ccccc2)cc(Cc2ccccc2)c1O |
| InChI | InChI=1S/C22H21NO2/c23-21(24)15-20-14-18(11-16-7-3-1-4-8-16)13-19(22(20)25)12-17-9-5-2-6-10-17/h1-10,13-14,25H,11-12,15H2,(H2,23,24) |
| InChIKey | DGUSLPYUWFIOJB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |