C25H36Se — CID 14399939
2-benzylselanyl-1,3,5-tritert-butylbenzene (PubChem CID 14399939) has the molecular formula C25H36Se and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-benzylselanyl-1,3,5-tritert-butylbenzene.
| Compound Name | 2-benzylselanyl-1,3,5-tritert-butylbenzene |
|---|---|
| PubChem CID | 14399939 |
| Molecular Formula | C25H36Se |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-benzylselanyl-1,3,5-tritert-butylbenzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c([Se]Cc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H36Se/c1-23(2,3)19-15-20(24(4,5)6)22(21(16-19)25(7,8)9)26-17-18-13-11-10-12-14-18/h10-16H,17H2,1-9H3 |
| InChIKey | BRHLBDNUUDTXPO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|