About CID 54309232
CID 54309232 (PubChem CID 54309232) has the molecular formula C21H28B
and a molecular weight of 291.27 g/mol.
Molecular Properties
| Compound Name | CID 54309232 |
| PubChem CID | 54309232 |
| Molecular Formula | C21H28B |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1[B]Cc1ccccc1 |
| InChI | InChI=1S/C21H28B/c1-20(2,3)17-13-10-14-18(21(4,5)6)19(17)22-15-16-11-8-7-9-12-16/h7-14H,15H2,1-6H3 |
| InChIKey | OCQMWRFTOQBRFX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 54309232 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 54309232?
The IUPAC name of CID 54309232 (CID 54309232) is not available.
What is the SMILES notation for CID 54309232?
The canonical SMILES for CID 54309232 is CC(C)(C)c1cccc(C(C)(C)C)c1[B]Cc1ccccc1.
What is the InChIKey of CID 54309232?
The InChIKey is OCQMWRFTOQBRFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28B/c1-20(2,3)17-13-10-14-18(21(4,5)6)19(17)22-15-16-11-8-7-9-12-16/h7-14H,15H2,1-6H3.
What are the key properties of CID 54309232?
CID 54309232 has a molecular weight of 291.27 g/mol, XLogP of 4.81, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 54309232 is sourced from PubChem (CID 54309232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).