About CID 91350408
CID 91350408 (PubChem CID 91350408) has the molecular formula C14H14B
and a molecular weight of 193.08 g/mol.
Molecular Properties
| Compound Name | CID 91350408 |
| PubChem CID | 91350408 |
| Molecular Formula | C14H14B |
| Molecular Weight | 193.08 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | — |
| SMILES | Cc1cccc([B]Cc2ccccc2)c1 |
| InChI | InChI=1S/C14H14B/c1-12-6-5-9-14(10-12)15-11-13-7-3-2-4-8-13/h2-10H,11H2,1H3 |
| InChIKey | UPAWPNJAEIZZBL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.08 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 91350408 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91350408?
The IUPAC name of CID 91350408 (CID 91350408) is not available.
What is the SMILES notation for CID 91350408?
The canonical SMILES for CID 91350408 is Cc1cccc([B]Cc2ccccc2)c1.
What is the InChIKey of CID 91350408?
The InChIKey is UPAWPNJAEIZZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14B/c1-12-6-5-9-14(10-12)15-11-13-7-3-2-4-8-13/h2-10H,11H2,1H3.
What are the key properties of CID 91350408?
CID 91350408 has a molecular weight of 193.08 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91350408 is sourced from PubChem (CID 91350408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).