C23H33NO — CID 68714462
2-(2,4-ditert-butyl-6-phenylmethoxyphenyl)ethanamine (PubChem CID 68714462) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 2-(2,4-ditert-butyl-6-phenylmethoxyphenyl)ethanamine.
| Compound Name | 2-(2,4-ditert-butyl-6-phenylmethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 68714462 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 2-(2,4-ditert-butyl-6-phenylmethoxyphenyl)ethanamine |
| SMILES | CC(C)(C)c1cc(OCc2ccccc2)c(CCN)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H33NO/c1-22(2,3)18-14-20(23(4,5)6)19(12-13-24)21(15-18)25-16-17-10-8-7-9-11-17/h7-11,14-15H,12-13,16,24H2,1-6H3 |
| InChIKey | KWSRDSQDMBYHDY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |