C28H34Se2 — CID 100934762
1,4-bis[(4-tert-butylphenyl)selanylmethyl]benzene (PubChem CID 100934762) has the molecular formula C28H34Se2 and a molecular weight of 528.50 g/mol. Its IUPAC name is 1,4-bis[(4-tert-butylphenyl)selanylmethyl]benzene.
| Compound Name | 1,4-bis[(4-tert-butylphenyl)selanylmethyl]benzene |
|---|---|
| PubChem CID | 100934762 |
| Molecular Formula | C28H34Se2 |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 1,4-bis[(4-tert-butylphenyl)selanylmethyl]benzene |
| SMILES | CC(C)(C)c1ccc([Se]Cc2ccc(C[Se]c3ccc(C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H34Se2/c1-27(2,3)23-11-15-25(16-12-23)29-19-21-7-9-22(10-8-21)20-30-26-17-13-24(14-18-26)28(4,5)6/h7-18H,19-20H2,1-6H3 |
| InChIKey | PLGVWNKPDYZMTP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|