C32H50OP2 — CID 135083263
[2,6-di(butan-2-yl)phenoxy]-(2,4,6-tritert-butylphenyl)phosphanylidenephosphane (PubChem CID 135083263) has the molecular formula C32H50OP2 and a molecular weight of 512.70 g/mol. Its IUPAC name is [2,6-di(butan-2-yl)phenoxy]-(2,4,6-tritert-butylphenyl)phosphanylidenephosphane.
| Compound Name | [2,6-di(butan-2-yl)phenoxy]-(2,4,6-tritert-butylphenyl)phosphanylidenephosphane |
|---|---|
| PubChem CID | 135083263 |
| Molecular Formula | C32H50OP2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | [2,6-di(butan-2-yl)phenoxy]-(2,4,6-tritert-butylphenyl)phosphanylidenephosphane |
| SMILES | CCC(C)c1cccc(C(C)CC)c1O/P=P/c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C32H50OP2/c1-14-21(3)24-17-16-18-25(22(4)15-2)28(24)33-35-34-29-26(31(8,9)10)19-23(30(5,6)7)20-27(29)32(11,12)13/h16-22H,14-15H2,1-13H3 |
| InChIKey | YGYLVCUNCIZNCT-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|