About (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate
(5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate (PubChem CID 58078988) has the molecular formula C19H24O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate.
Molecular Properties
| Compound Name | (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate |
| PubChem CID | 58078988 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate |
| SMILES | CCC(C)c1cccc2c(OC(=O)OC(C)(C)C)cccc12 |
| InChI | InChI=1S/C19H24O3/c1-6-13(2)14-9-7-11-16-15(14)10-8-12-17(16)21-18(20)22-19(3,4)5/h7-13H,6H2,1-5H3 |
| InChIKey | BIWHVMVAINDHPD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate?
The IUPAC name of (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate (CID 58078988) is (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate.
What is the SMILES notation for (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate?
The canonical SMILES for (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate is CCC(C)c1cccc2c(OC(=O)OC(C)(C)C)cccc12.
What is the InChIKey of (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate?
The InChIKey is BIWHVMVAINDHPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O3/c1-6-13(2)14-9-7-11-16-15(14)10-8-12-17(16)21-18(20)22-19(3,4)5/h7-13H,6H2,1-5H3.
What are the key properties of (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate?
(5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate has a molecular weight of 300.40 g/mol, XLogP of 5.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-butan-2-ylnaphthalen-1-yl) tert-butyl carbonate is sourced from PubChem (CID 58078988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).