C38H57O3P — CID 66803662
[4-tert-butyl-2-(2,4-ditert-butylphenyl)phenyl]-(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane (PubChem CID 66803662) has the molecular formula C38H57O3P and a molecular weight of 592.85 g/mol. Its IUPAC name is [4-tert-butyl-2-(2,4-ditert-butylphenyl)phenyl]-(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane.
| Compound Name | [4-tert-butyl-2-(2,4-ditert-butylphenyl)phenyl]-(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane |
|---|---|
| PubChem CID | 66803662 |
| Molecular Formula | C38H57O3P |
| Molecular Weight | 592.85 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | [4-tert-butyl-2-(2,4-ditert-butylphenyl)phenyl]-(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane |
| SMILES | CC(C)(C)c1ccc(P(O)(O)(O)c2ccc(C(C)(C)C)cc2C(C)(C)C)c(-c2ccc(C(C)(C)C)cc2C(C)(C)C)c1 |
| InChI | InChI=1S/C38H57O3P/c1-34(2,3)25-17-20-32(29(22-25)28-19-16-26(35(4,5)6)23-30(28)37(10,11)12)42(39,40,41)33-21-18-27(36(7,8)9)24-31(33)38(13,14)15/h16-24,39-41H,1-15H3 |
| InChIKey | WLGDKIXHNYWITM-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.85 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|